C7H13N3O2 — CID 157349847
(4S,5S)-5-azido-4,6-dimethyloxan-3-ol (PubChem CID 157349847) has the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. Its IUPAC name is (4S,5S)-5-azido-4,6-dimethyloxan-3-ol.
| Compound Name | (4S,5S)-5-azido-4,6-dimethyloxan-3-ol |
|---|---|
| PubChem CID | 157349847 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | (4S,5S)-5-azido-4,6-dimethyloxan-3-ol |
| SMILES | CC1OCC(O)[C@@H](C)[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C7H13N3O2/c1-4-6(11)3-12-5(2)7(4)9-10-8/h4-7,11H,3H2,1-2H3/t4-,5?,6?,7+/m1/s1 |
| InChIKey | QUZHEQTXHSRDLY-BLOUUBGSSA-N |
| XLogP | 1.08 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|