C5H9N3O2 — CID 130822614
cis-(1R,3S)-2-azidocyclopentane-1,3-diol (PubChem CID 130822614) has the molecular formula C5H9N3O2 and a molecular weight of 143.15 g/mol. Its IUPAC name is cis-(1R,3S)-2-azidocyclopentane-1,3-diol.
| Compound Name | cis-(1R,3S)-2-azidocyclopentane-1,3-diol |
|---|---|
| PubChem CID | 130822614 |
| Molecular Formula | C5H9N3O2 |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | cis-(1R,3S)-2-azidocyclopentane-1,3-diol |
| SMILES | [N-]=[N+]=NC1[C@H](O)CC[C@@H]1O |
| InChI | InChI=1S/C5H9N3O2/c6-8-7-5-3(9)1-2-4(5)10/h3-5,9-10H,1-2H2/t3-,4+,5? |
| InChIKey | MPJKNBWECCYQQD-NGQZWQHPSA-N |
| XLogP | 0.18 |
| TPSA | 89.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|