C16H24N6O6 — CID 102020779
(2R,3R,4R,4aR,8aS)-2-[(2S,3R,4R,4aR,8aS)-3-azido-4-hydroxy-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]-3-azido-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-4-ol (PubChem CID 102020779) has the molecular formula C16H24N6O6 and a molecular weight of 396.40 g/mol. Its IUPAC name is (2R,3R,4R,4aR,8aS)-2-[(2S,3R,4R,4aR,8aS)-3-azido-4-hydroxy-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]-3-azido-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-4-ol.
| Compound Name | (2R,3R,4R,4aR,8aS)-2-[(2S,3R,4R,4aR,8aS)-3-azido-4-hydroxy-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]-3-azido-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-4-ol |
|---|---|
| PubChem CID | 102020779 |
| Molecular Formula | C16H24N6O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (2R,3R,4R,4aR,8aS)-2-[(2S,3R,4R,4aR,8aS)-3-azido-4-hydroxy-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]-3-azido-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-4-ol |
| SMILES | [N-]=[N+]=N[C@@H]1[C@@H](O)[C@H]2OCCC[C@@H]2O[C@H]1[C@H]1O[C@H]2CCCO[C@@H]2[C@H](O)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C16H24N6O6/c17-21-19-9-11(23)13-7(3-1-5-25-13)27-15(9)16-10(20-22-18)12(24)14-8(28-16)4-2-6-26-14/h7-16,23-24H,1-6H2/t7-,8-,9+,10+,11+,12+,13-,14-,15-,16+/m0/s1 |
| InChIKey | OIKZLTKUICUZLZ-AXDXUGCISA-N |
| XLogP | 0.96 |
| TPSA | 174.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|