C6H8BrN3O3 — CID 11010361
(1R,2S,3S,4S,5S,6S)-5-azido-3-bromo-7-oxabicyclo[4.1.0]heptane-2,4-diol (PubChem CID 11010361) has the molecular formula C6H8BrN3O3 and a molecular weight of 250.05 g/mol. Its IUPAC name is (1R,2S,3S,4S,5S,6S)-5-azido-3-bromo-7-oxabicyclo[4.1.0]heptane-2,4-diol.
| Compound Name | (1R,2S,3S,4S,5S,6S)-5-azido-3-bromo-7-oxabicyclo[4.1.0]heptane-2,4-diol |
|---|---|
| PubChem CID | 11010361 |
| Molecular Formula | C6H8BrN3O3 |
| Molecular Weight | 250.05 g/mol |
| Exact Mass | 248.97 |
| IUPAC Name | (1R,2S,3S,4S,5S,6S)-5-azido-3-bromo-7-oxabicyclo[4.1.0]heptane-2,4-diol |
| SMILES | [N-]=[N+]=N[C@H]1[C@H](O)[C@H](Br)[C@@H](O)[C@H]2O[C@@H]12 |
| InChI | InChI=1S/C6H8BrN3O3/c7-1-3(11)2(9-10-8)5-6(13-5)4(1)12/h1-6,11-12H/t1-,2-,3+,4+,5-,6+/m0/s1 |
| InChIKey | IEVMVCNVPYAPRL-FTYOSCRSSA-N |
| XLogP | -0.07 |
| TPSA | 101.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.05 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|