C6H10N6O4 — CID 124636003
(2S,3R,4R,5S,6S)-4-azido-6-(azidomethyl)oxane-2,3,5-triol (PubChem CID 124636003) has the molecular formula C6H10N6O4 and a molecular weight of 230.18 g/mol. Its IUPAC name is (2S,3R,4R,5S,6S)-4-azido-6-(azidomethyl)oxane-2,3,5-triol.
| Compound Name | (2S,3R,4R,5S,6S)-4-azido-6-(azidomethyl)oxane-2,3,5-triol |
|---|---|
| PubChem CID | 124636003 |
| Molecular Formula | C6H10N6O4 |
| Molecular Weight | 230.18 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | (2S,3R,4R,5S,6S)-4-azido-6-(azidomethyl)oxane-2,3,5-triol |
| SMILES | [N-]=[N+]=NC[C@@H]1O[C@H](O)[C@H](O)[C@H](N=[N+]=[N-])[C@@H]1O |
| InChI | InChI=1S/C6H10N6O4/c7-11-9-1-2-4(13)3(10-12-8)5(14)6(15)16-2/h2-6,13-15H,1H2/t2-,3+,4+,5+,6-/m0/s1 |
| InChIKey | IWIPLQNGULKODP-BSQWINAVSA-N |
| XLogP | -0.59 |
| TPSA | 167.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.18 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|