C6H11Ac4N3O5 — CID 59078250
actinium;(3R,4S,5S,6R)-6-(azidomethyl)oxane-2,3,4,5-tetrol (PubChem CID 59078250) has the molecular formula C6H11Ac4N3O5 and a molecular weight of 1113.17 g/mol. Its IUPAC name is actinium;(3R,4S,5S,6R)-6-(azidomethyl)oxane-2,3,4,5-tetrol.
| Compound Name | actinium;(3R,4S,5S,6R)-6-(azidomethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 59078250 |
| Molecular Formula | C6H11Ac4N3O5 |
| Molecular Weight | 1113.17 g/mol |
| Exact Mass | 1113.18 |
| IUPAC Name | actinium;(3R,4S,5S,6R)-6-(azidomethyl)oxane-2,3,4,5-tetrol |
| SMILES | [Ac].[Ac].[Ac].[Ac].[N-]=[N+]=NC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H11N3O5.4Ac/c7-9-8-1-2-3(10)4(11)5(12)6(13)14-2;;;;/h2-6,10-13H,1H2;;;;/t2-,3-,4+,5-,6?;;;;/m1..../s1 |
| InChIKey | VPKFONDONZKLIT-GYFKKTTESA-N |
| XLogP | -1.90 |
| TPSA | 138.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1113.17 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|