C8H15N3O4 — CID 71122120
2-(azidomethyl)-6-ethyloxane-3,4,5-triol (PubChem CID 71122120) has the molecular formula C8H15N3O4 and a molecular weight of 217.22 g/mol. Its IUPAC name is 2-(azidomethyl)-6-ethyloxane-3,4,5-triol.
| Compound Name | 2-(azidomethyl)-6-ethyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 71122120 |
| Molecular Formula | C8H15N3O4 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 2-(azidomethyl)-6-ethyloxane-3,4,5-triol |
| SMILES | CCC1OC(CN=[N+]=[N-])C(O)C(O)C1O |
| InChI | InChI=1S/C8H15N3O4/c1-2-4-6(12)8(14)7(13)5(15-4)3-10-11-9/h4-8,12-14H,2-3H2,1H3 |
| InChIKey | XNBKXXIABRZRAT-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 118.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|