C18H31Ac9Br3N6O12 — CID 160707784
actinium;(6R)-4-azido-2-bromo-6-(hydroxymethyl)oxane-3,5-diol;(2R)-2-(azidomethyl)-6-bromooxane-3,4,5-triol;2-bromo-6-methyloxane-3,4,5-triol (PubChem CID 160707784) has the molecular formula C18H31Ac9Br3N6O12 and a molecular weight of 2806.19 g/mol. Its IUPAC name is actinium;(6R)-4-azido-2-bromo-6-(hydroxymethyl)oxane-3,5-diol;(2R)-2-(azidomethyl)-6-bromooxane-3,4,5-triol;2-bromo-6-methyloxane-3,4,5-triol.
| Compound Name | actinium;(6R)-4-azido-2-bromo-6-(hydroxymethyl)oxane-3,5-diol;(2R)-2-(azidomethyl)-6-bromooxane-3,4,5-triol;2-bromo-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 160707784 |
| Molecular Formula | C18H31Ac9Br3N6O12 |
| Molecular Weight | 2806.19 g/mol |
| Exact Mass | 2803.20 |
| IUPAC Name | actinium;(6R)-4-azido-2-bromo-6-(hydroxymethyl)oxane-3,5-diol;(2R)-2-(azidomethyl)-6-bromooxane-3,4,5-triol;2-bromo-6-methyloxane-3,4,5-triol |
| SMILES | CC1OC(Br)C(O)C(O)C1O.[Ac].[Ac].[Ac].[Ac].[Ac].[Ac].[Ac].[Ac].[Ac].[N-]=[N+]=NC1C(O)C(Br)O[C@H](CO)C1O.[N-]=[N+]=NC[C@H]1OC(Br)C(O)C(O)C1O |
| InChI | InChI=1S/2C6H10BrN3O4.C6H11BrO4.9Ac/c7-6-5(13)3(9-10-8)4(12)2(1-11)14-6;7-6-5(13)4(12)3(11)2(14-6)1-9-10-8;1-2-3(8)4(9)5(10)6(7)11-2;;;;;;;;;/h2*2-6,11-13H,1H2;2-6,8-10H,1H3;;;;;;;;;/t2*2-,3?,4?,5?,6?;;;;;;;;;;/m11........../s1 |
| InChIKey | RMFXBRXDDPFWPC-IGLWYJQBSA-N |
| XLogP | -1.79 |
| TPSA | 307.28 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 2806.19 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|