C5H7N3O5 — CID 90744967
(2S,3S,4R)-3-azido-4,5-dihydroxyoxolane-2-carboxylic acid (PubChem CID 90744967) has the molecular formula C5H7N3O5 and a molecular weight of 189.13 g/mol. Its IUPAC name is (2S,3S,4R)-3-azido-4,5-dihydroxyoxolane-2-carboxylic acid.
| Compound Name | (2S,3S,4R)-3-azido-4,5-dihydroxyoxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 90744967 |
| Molecular Formula | C5H7N3O5 |
| Molecular Weight | 189.13 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | (2S,3S,4R)-3-azido-4,5-dihydroxyoxolane-2-carboxylic acid |
| SMILES | [N-]=[N+]=N[C@@H]1[C@@H](C(=O)O)OC(O)[C@@H]1O |
| InChI | InChI=1S/C5H7N3O5/c6-8-7-1-2(9)5(12)13-3(1)4(10)11/h1-3,5,9,12H,(H,10,11)/t1-,2+,3-,5?/m0/s1 |
| InChIKey | JJSSXOWHHXHCTN-VLIATHEQSA-N |
| XLogP | -1.17 |
| TPSA | 135.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.13 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|