C6H11NO6 — CID 129100402
(2S,4S,5R,6S)-3-amino-4,5,6-trihydroxyoxane-2-carboxylic acid (PubChem CID 129100402) has the molecular formula C6H11NO6 and a molecular weight of 193.16 g/mol. Its IUPAC name is (2S,4S,5R,6S)-3-amino-4,5,6-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,4S,5R,6S)-3-amino-4,5,6-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 129100402 |
| Molecular Formula | C6H11NO6 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | (2S,4S,5R,6S)-3-amino-4,5,6-trihydroxyoxane-2-carboxylic acid |
| SMILES | NC1[C@@H](C(=O)O)O[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H11NO6/c7-1-2(8)3(9)6(12)13-4(1)5(10)11/h1-4,6,8-9,12H,7H2,(H,10,11)/t1?,2-,3+,4-,6-/m0/s1 |
| InChIKey | IHPOKRCSLHOPES-SBYLPQMWSA-N |
| XLogP | -3.16 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |