(2S,4S,5R,6S)-3-amino-4,5,6-trihydroxyoxane-2-carboxylic acid

C6H11NO6 — CID 129100402

IUPAC(2S,4S,5R,6S)-3-amino-4,5,6-trihydroxyoxane-2-carboxylic acid
SMILESNC1[C@@H](C(=O)O)O[C@H](O)[C@H](O)[C@H]1O
InChIInChI=1S/C6H11NO6/c7-1-2(8)3(9)6(12)13-4(1)5(10)11/h1-4,6,8-9,12H,7H2,(H,10,11)/t1?,2-,3+,4-,6-/m0/s1
InChIKeyIHPOKRCSLHOPES-SBYLPQMWSA-N
MW193.16 g/mol
LogP-3.16
Rot. Bonds1

About (2S,4S,5R,6S)-3-amino-4,5,6-trihydroxyoxane-2-carboxylic acid

(2S,4S,5R,6S)-3-amino-4,5,6-trihydroxyoxane-2-carboxylic acid (PubChem CID 129100402) has the molecular formula C6H11NO6 and a molecular weight of 193.16 g/mol. Its IUPAC name is (2S,4S,5R,6S)-3-amino-4,5,6-trihydroxyoxane-2-carboxylic acid.

Molecular Properties

Compound Name(2S,4S,5R,6S)-3-amino-4,5,6-trihydroxyoxane-2-carboxylic acid
PubChem CID129100402
Molecular FormulaC6H11NO6
Molecular Weight193.16 g/mol
Exact Mass193.06
IUPAC Name(2S,4S,5R,6S)-3-amino-4,5,6-trihydroxyoxane-2-carboxylic acid
SMILESNC1[C@@H](C(=O)O)O[C@H](O)[C@H](O)[C@H]1O
InChIInChI=1S/C6H11NO6/c7-1-2(8)3(9)6(12)13-4(1)5(10)11/h1-4,6,8-9,12H,7H2,(H,10,11)/t1?,2-,3+,4-,6-/m0/s1
InChIKeyIHPOKRCSLHOPES-SBYLPQMWSA-N
XLogP-3.16
TPSA133.24 Ų
H-Bond Donors5
H-Bond Acceptors6
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.16
LogP ≤ 5-3.16
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 106

Analyze (2S,4S,5R,6S)-3-amino-4,5,6-trihydroxyoxane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,4S,5R,6S)-3-amino-4,5,6-trihydroxyoxane-2-carboxylic acid?
The IUPAC name of (2S,4S,5R,6S)-3-amino-4,5,6-trihydroxyoxane-2-carboxylic acid (CID 129100402) is (2S,4S,5R,6S)-3-amino-4,5,6-trihydroxyoxane-2-carboxylic acid.
What is the SMILES notation for (2S,4S,5R,6S)-3-amino-4,5,6-trihydroxyoxane-2-carboxylic acid?
The canonical SMILES for (2S,4S,5R,6S)-3-amino-4,5,6-trihydroxyoxane-2-carboxylic acid is NC1[C@@H](C(=O)O)O[C@H](O)[C@H](O)[C@H]1O.
What is the InChIKey of (2S,4S,5R,6S)-3-amino-4,5,6-trihydroxyoxane-2-carboxylic acid?
The InChIKey is IHPOKRCSLHOPES-SBYLPQMWSA-N. The full InChI is InChI=1S/C6H11NO6/c7-1-2(8)3(9)6(12)13-4(1)5(10)11/h1-4,6,8-9,12H,7H2,(H,10,11)/t1?,2-,3+,4-,6-/m0/s1.
What are the key properties of (2S,4S,5R,6S)-3-amino-4,5,6-trihydroxyoxane-2-carboxylic acid?
(2S,4S,5R,6S)-3-amino-4,5,6-trihydroxyoxane-2-carboxylic acid has a molecular weight of 193.16 g/mol, XLogP of -3.16, 1 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4S,5R,6S)-3-amino-4,5,6-trihydroxyoxane-2-carboxylic acid is sourced from PubChem (CID 129100402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).