C12H23NO7 — CID 174768614
cyclohexanamine;(2S,3S,4S,5S,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid (PubChem CID 174768614) has the molecular formula C12H23NO7 and a molecular weight of 293.32 g/mol. Its IUPAC name is cyclohexanamine;(2S,3S,4S,5S,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid.
| Compound Name | cyclohexanamine;(2S,3S,4S,5S,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 174768614 |
| Molecular Formula | C12H23NO7 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | cyclohexanamine;(2S,3S,4S,5S,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid |
| SMILES | NC1CCCCC1.O=C(O)[C@H]1O[C@@H](O)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13N.C6H10O7/c7-6-4-2-1-3-5-6;7-1-2(8)4(5(10)11)13-6(12)3(1)9/h6H,1-5,7H2;1-4,6-9,12H,(H,10,11)/t;1-,2-,3-,4-,6+/m.0/s1 |
| InChIKey | SZRGOLRHHQQDPR-BFIQUNSMSA-N |
| XLogP | -1.85 |
| TPSA | 153.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |