C12H14Cl2O7 — CID 131964016
1,2-dichlorobenzene;(2S,3S,4S,5R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid (PubChem CID 131964016) has the molecular formula C12H14Cl2O7 and a molecular weight of 341.14 g/mol. Its IUPAC name is 1,2-dichlorobenzene;(2S,3S,4S,5R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid.
| Compound Name | 1,2-dichlorobenzene;(2S,3S,4S,5R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 131964016 |
| Molecular Formula | C12H14Cl2O7 |
| Molecular Weight | 341.14 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 1,2-dichlorobenzene;(2S,3S,4S,5R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid |
| SMILES | Clc1ccccc1Cl.O=C(O)[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H4Cl2.C6H10O7/c7-5-3-1-2-4-6(5)8;7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4H;1-4,6-9,12H,(H,10,11)/t;1-,2-,3+,4-,6?/m.0/s1 |
| InChIKey | ZWVBLRRNXUDYPM-HVPGLEETSA-N |
| XLogP | -0.14 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.14 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |