C15H17ClN4O7 — CID 146019672
(2S,3S,4S,5R,6R)-6-[(1R)-1-(2-chlorophenyl)-2-(tetrazol-2-yl)ethoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 146019672) has the molecular formula C15H17ClN4O7 and a molecular weight of 400.78 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-6-[(1R)-1-(2-chlorophenyl)-2-(tetrazol-2-yl)ethoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6R)-6-[(1R)-1-(2-chlorophenyl)-2-(tetrazol-2-yl)ethoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 146019672 |
| Molecular Formula | C15H17ClN4O7 |
| Molecular Weight | 400.78 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | (2S,3S,4S,5R,6R)-6-[(1R)-1-(2-chlorophenyl)-2-(tetrazol-2-yl)ethoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1O[C@@H](O[C@@H](Cn2ncnn2)c2ccccc2Cl)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H17ClN4O7/c16-8-4-2-1-3-7(8)9(5-20-18-6-17-19-20)26-15-12(23)10(21)11(22)13(27-15)14(24)25/h1-4,6,9-13,15,21-23H,5H2,(H,24,25)/t9-,10-,11-,12+,13-,15+/m0/s1 |
| InChIKey | RBPOVMMAONRLJK-QBOXMOKDSA-N |
| XLogP | -1.02 |
| TPSA | 160.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.78 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |