C15H18O8 — CID 171114881
3,4,5-trihydroxy-6-(2-oxo-1-phenylpropoxy)oxane-2-carboxylic acid (PubChem CID 171114881) has the molecular formula C15H18O8 and a molecular weight of 326.30 g/mol. Its IUPAC name is 3,4,5-trihydroxy-6-(2-oxo-1-phenylpropoxy)oxane-2-carboxylic acid.
| Compound Name | 3,4,5-trihydroxy-6-(2-oxo-1-phenylpropoxy)oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 171114881 |
| Molecular Formula | C15H18O8 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 3,4,5-trihydroxy-6-(2-oxo-1-phenylpropoxy)oxane-2-carboxylic acid |
| SMILES | CC(=O)C(OC1OC(C(=O)O)C(O)C(O)C1O)c1ccccc1 |
| InChI | InChI=1S/C15H18O8/c1-7(16)12(8-5-3-2-4-6-8)22-15-11(19)9(17)10(18)13(23-15)14(20)21/h2-6,9-13,15,17-19H,1H3,(H,20,21) |
| InChIKey | KSHAJGOAURXZNB-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |