C20H28O8 — CID 171115014
6-[1-(4-tert-butylphenyl)-4-oxobutoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 171115014) has the molecular formula C20H28O8 and a molecular weight of 396.44 g/mol. Its IUPAC name is 6-[1-(4-tert-butylphenyl)-4-oxobutoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[1-(4-tert-butylphenyl)-4-oxobutoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 171115014 |
| Molecular Formula | C20H28O8 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 6-[1-(4-tert-butylphenyl)-4-oxobutoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(C(CCC=O)OC2OC(C(=O)O)C(O)C(O)C2O)cc1 |
| InChI | InChI=1S/C20H28O8/c1-20(2,3)12-8-6-11(7-9-12)13(5-4-10-21)27-19-16(24)14(22)15(23)17(28-19)18(25)26/h6-10,13-17,19,22-24H,4-5H2,1-3H3,(H,25,26) |
| InChIKey | CWDFAHAXVAGIQF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|