C6H10O10S — CID 175717862
(2S,3S,4R,5R)-4,5,6-trihydroxy-3-sulfooxyoxane-2-carboxylic acid (PubChem CID 175717862) has the molecular formula C6H10O10S and a molecular weight of 274.20 g/mol. Its IUPAC name is (2S,3S,4R,5R)-4,5,6-trihydroxy-3-sulfooxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4R,5R)-4,5,6-trihydroxy-3-sulfooxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 175717862 |
| Molecular Formula | C6H10O10S |
| Molecular Weight | 274.20 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | (2S,3S,4R,5R)-4,5,6-trihydroxy-3-sulfooxyoxane-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1OS(=O)(=O)O |
| InChI | InChI=1S/C6H10O10S/c7-1-2(8)6(11)15-4(5(9)10)3(1)16-17(12,13)14/h1-4,6-8,11H,(H,9,10)(H,12,13,14)/t1-,2-,3+,4+,6?/m1/s1 |
| InChIKey | RUPGFWRWLXQKDN-ISAMGBGPSA-N |
| XLogP | -3.30 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.20 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|