C9H13N3O6 — CID 101411138
(2S,3S,4S,4aR,7R,8aR)-7-azido-3,4-dihydroxy-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-carboxylic acid (PubChem CID 101411138) has the molecular formula C9H13N3O6 and a molecular weight of 259.22 g/mol. Its IUPAC name is (2S,3S,4S,4aR,7R,8aR)-7-azido-3,4-dihydroxy-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-carboxylic acid.
| Compound Name | (2S,3S,4S,4aR,7R,8aR)-7-azido-3,4-dihydroxy-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-carboxylic acid |
|---|---|
| PubChem CID | 101411138 |
| Molecular Formula | C9H13N3O6 |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | (2S,3S,4S,4aR,7R,8aR)-7-azido-3,4-dihydroxy-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-carboxylic acid |
| SMILES | [N-]=[N+]=N[C@H]1CO[C@@H]2[C@@H](O)[C@H](O)[C@@H](C(=O)O)O[C@@H]2C1 |
| InChI | InChI=1S/C9H13N3O6/c10-12-11-3-1-4-7(17-2-3)5(13)6(14)8(18-4)9(15)16/h3-8,13-14H,1-2H2,(H,15,16)/t3-,4-,5+,6+,7+,8+/m1/s1 |
| InChIKey | BIYXUMJSWWAEAR-LVTNRUAJSA-N |
| XLogP | -0.97 |
| TPSA | 144.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|