C6H9N3O6 — CID 71313570
(2S,3R,4R,5R)-5-azido-3,4,6-trihydroxyoxane-2-carboxylic acid (PubChem CID 71313570) has the molecular formula C6H9N3O6 and a molecular weight of 219.15 g/mol. Its IUPAC name is (2S,3R,4R,5R)-5-azido-3,4,6-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3R,4R,5R)-5-azido-3,4,6-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 71313570 |
| Molecular Formula | C6H9N3O6 |
| Molecular Weight | 219.15 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | (2S,3R,4R,5R)-5-azido-3,4,6-trihydroxyoxane-2-carboxylic acid |
| SMILES | [N-]=[N+]=N[C@H]1C(O)O[C@H](C(=O)O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H9N3O6/c7-9-8-1-2(10)3(11)4(5(12)13)15-6(1)14/h1-4,6,10-11,14H,(H,12,13)/t1-,2-,3-,4+,6?/m1/s1 |
| InChIKey | LHNGMVUPXLPGAZ-BZINKQHNSA-N |
| XLogP | -1.81 |
| TPSA | 155.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.15 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|