C6H10O2 — CID 98116091
(1R,2R,6R)-7-oxabicyclo[4.1.0]heptan-2-ol (PubChem CID 98116091) has the molecular formula C6H10O2 and a molecular weight of 114.14 g/mol. Its IUPAC name is (1R,2R,6R)-7-oxabicyclo[4.1.0]heptan-2-ol.
| Compound Name | (1R,2R,6R)-7-oxabicyclo[4.1.0]heptan-2-ol |
|---|---|
| PubChem CID | 98116091 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | (1R,2R,6R)-7-oxabicyclo[4.1.0]heptan-2-ol |
| SMILES | O[C@@H]1CCC[C@H]2O[C@H]12 |
| InChI | InChI=1S/C6H10O2/c7-4-2-1-3-5-6(4)8-5/h4-7H,1-3H2/t4-,5-,6-/m1/s1 |
| InChIKey | NTUQPJNKERXQPA-HSUXUTPPSA-N |
| XLogP | 0.30 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|