About 2,7-dioxatricyclo[4.4.0.03,8]decan-4-ol
2,7-dioxatricyclo[4.4.0.03,8]decan-4-ol (PubChem CID 130124205) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is 2,7-dioxatricyclo[4.4.0.03,8]decan-4-ol.
Molecular Properties
| Compound Name | 2,7-dioxatricyclo[4.4.0.03,8]decan-4-ol |
| PubChem CID | 130124205 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 2,7-dioxatricyclo[4.4.0.03,8]decan-4-ol |
| SMILES | OC1CC2OC3CCC2OC13 |
| InChI | InChI=1S/C8H12O3/c9-4-3-7-5-1-2-6(10-7)8(4)11-5/h4-9H,1-3H2 |
| InChIKey | CMBAYGJLKPFHNC-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,7-dioxatricyclo[4.4.0.03,8]decan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dioxatricyclo[4.4.0.03,8]decan-4-ol?
The IUPAC name of 2,7-dioxatricyclo[4.4.0.03,8]decan-4-ol (CID 130124205) is 2,7-dioxatricyclo[4.4.0.03,8]decan-4-ol.
What is the SMILES notation for 2,7-dioxatricyclo[4.4.0.03,8]decan-4-ol?
The canonical SMILES for 2,7-dioxatricyclo[4.4.0.03,8]decan-4-ol is OC1CC2OC3CCC2OC13.
What is the InChIKey of 2,7-dioxatricyclo[4.4.0.03,8]decan-4-ol?
The InChIKey is CMBAYGJLKPFHNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3/c9-4-3-7-5-1-2-6(10-7)8(4)11-5/h4-9H,1-3H2.
What are the key properties of 2,7-dioxatricyclo[4.4.0.03,8]decan-4-ol?
2,7-dioxatricyclo[4.4.0.03,8]decan-4-ol has a molecular weight of 156.18 g/mol, XLogP of 0.07, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dioxatricyclo[4.4.0.03,8]decan-4-ol is sourced from PubChem (CID 130124205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).