C12H18O2 — CID 102330516
(1S,2R,5E,9Z,12R)-13-oxabicyclo[10.1.0]trideca-5,9-dien-2-ol (PubChem CID 102330516) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (1S,2R,5E,9Z,12R)-13-oxabicyclo[10.1.0]trideca-5,9-dien-2-ol.
| Compound Name | (1S,2R,5E,9Z,12R)-13-oxabicyclo[10.1.0]trideca-5,9-dien-2-ol |
|---|---|
| PubChem CID | 102330516 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (1S,2R,5E,9Z,12R)-13-oxabicyclo[10.1.0]trideca-5,9-dien-2-ol |
| SMILES | O[C@@H]1CC/C=C/CC/C=C\C[C@H]2O[C@@H]12 |
| InChI | InChI=1S/C12H18O2/c13-10-8-6-4-2-1-3-5-7-9-11-12(10)14-11/h2,4-5,7,10-13H,1,3,6,8-9H2/b4-2+,7-5-/t10-,11-,12+/m1/s1 |
| InChIKey | AFVVDFJMXHMRQG-PXBOORHDSA-N |
| XLogP | 2.19 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|