C6H9N3O3 — CID 130980047
(1R,2R,3S,4R)-3-azidocyclohex-5-ene-1,2,4-triol (PubChem CID 130980047) has the molecular formula C6H9N3O3 and a molecular weight of 171.16 g/mol. Its IUPAC name is (1R,2R,3S,4R)-3-azidocyclohex-5-ene-1,2,4-triol.
| Compound Name | (1R,2R,3S,4R)-3-azidocyclohex-5-ene-1,2,4-triol |
|---|---|
| PubChem CID | 130980047 |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | (1R,2R,3S,4R)-3-azidocyclohex-5-ene-1,2,4-triol |
| SMILES | [N-]=[N+]=N[C@@H]1[C@@H](O)[C@H](O)C=C[C@H]1O |
| InChI | InChI=1S/C6H9N3O3/c7-9-8-5-3(10)1-2-4(11)6(5)12/h1-6,10-12H/t3-,4-,5+,6+/m1/s1 |
| InChIKey | DLZRWQKHNMORNX-ZXXMMSQZSA-N |
| XLogP | -0.68 |
| TPSA | 109.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|