C6H9N3O3 — CID 160728491
(3R,4R)-3-azido-2-(hydroxymethyl)-3,4-dihydro-2H-pyran-4-ol (PubChem CID 160728491) has the molecular formula C6H9N3O3 and a molecular weight of 171.16 g/mol. Its IUPAC name is (3R,4R)-3-azido-2-(hydroxymethyl)-3,4-dihydro-2H-pyran-4-ol.
| Compound Name | (3R,4R)-3-azido-2-(hydroxymethyl)-3,4-dihydro-2H-pyran-4-ol |
|---|---|
| PubChem CID | 160728491 |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | (3R,4R)-3-azido-2-(hydroxymethyl)-3,4-dihydro-2H-pyran-4-ol |
| SMILES | [N-]=[N+]=N[C@H]1C(CO)OC=C[C@H]1O |
| InChI | InChI=1S/C6H9N3O3/c7-9-8-6-4(11)1-2-12-5(6)3-10/h1-2,4-6,10-11H,3H2/t4-,5?,6-/m1/s1 |
| InChIKey | PFUHZIHZQHNOFQ-SPWIIUKKSA-N |
| XLogP | -0.07 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|