C5H9N3O3 — CID 151447306
(2R,3R,5R)-5-azido-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 151447306) has the molecular formula C5H9N3O3 and a molecular weight of 159.14 g/mol. Its IUPAC name is (2R,3R,5R)-5-azido-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,5R)-5-azido-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 151447306 |
| Molecular Formula | C5H9N3O3 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.06 |
| IUPAC Name | (2R,3R,5R)-5-azido-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | [N-]=[N+]=N[C@H]1C[C@@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C5H9N3O3/c6-8-7-5-1-3(10)4(2-9)11-5/h3-5,9-10H,1-2H2/t3-,4-,5-/m1/s1 |
| InChIKey | PFTILNMDTFERLZ-UOWFLXDJSA-N |
| XLogP | -0.24 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|