About CID 59914550
CID 59914550 (PubChem CID 59914550) has the molecular formula C5H9BO3
and a molecular weight of 127.94 g/mol.
Molecular Properties
| Compound Name | CID 59914550 |
| PubChem CID | 59914550 |
| Molecular Formula | C5H9BO3 |
| Molecular Weight | 127.94 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | — |
| SMILES | [B][C@H]1C[C@@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C5H9BO3/c6-5-1-3(8)4(2-7)9-5/h3-5,7-8H,1-2H2/t3-,4-,5-/m1/s1 |
| InChIKey | LAHNHABTYBWIBB-UOWFLXDJSA-N |
| XLogP | -1.38 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.94 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59914550 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59914550?
The IUPAC name of CID 59914550 (CID 59914550) is not available.
What is the SMILES notation for CID 59914550?
The canonical SMILES for CID 59914550 is [B][C@H]1C[C@@H](O)[C@@H](CO)O1.
What is the InChIKey of CID 59914550?
The InChIKey is LAHNHABTYBWIBB-UOWFLXDJSA-N. The full InChI is InChI=1S/C5H9BO3/c6-5-1-3(8)4(2-7)9-5/h3-5,7-8H,1-2H2/t3-,4-,5-/m1/s1.
What are the key properties of CID 59914550?
CID 59914550 has a molecular weight of 127.94 g/mol, XLogP of -1.38, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59914550 is sourced from PubChem (CID 59914550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).