C5H8O3 — CID 163959935
(2R)-2-(hydroxymethyl)-2,3-dihydrofuran-3-ol (PubChem CID 163959935) has the molecular formula C5H8O3 and a molecular weight of 116.12 g/mol. Its IUPAC name is (2R)-2-(hydroxymethyl)-2,3-dihydrofuran-3-ol.
| Compound Name | (2R)-2-(hydroxymethyl)-2,3-dihydrofuran-3-ol |
|---|---|
| PubChem CID | 163959935 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.05 |
| IUPAC Name | (2R)-2-(hydroxymethyl)-2,3-dihydrofuran-3-ol |
| SMILES | OC[C@H]1OC=CC1O |
| InChI | InChI=1S/C5H8O3/c6-3-5-4(7)1-2-8-5/h1-2,4-7H,3H2/t4?,5-/m1/s1 |
| InChIKey | SGOSIWMWLVSBIC-BRJRFNKRSA-N |
| XLogP | -0.75 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |