C6H11O5 — CID 57450511
glucopyranosyl radical (PubChem CID 57450511) has the molecular formula C6H11O5 and a molecular weight of 163.15 g/mol.
| Compound Name | glucopyranosyl radical |
|---|---|
| PubChem CID | 57450511 |
| Molecular Formula | C6H11O5 |
| Molecular Weight | 163.15 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | — |
| SMILES | OC[C@H]1O[CH][C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H11O5/c7-1-4-6(10)5(9)3(8)2-11-4/h2-10H,1H2/t3-,4+,5+,6+/m0/s1 |
| InChIKey | FWIVUUAQJLPCSQ-SLPGGIOYSA-N |
| XLogP | -2.38 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.15 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |