C7H12O3 — CID 118517723
(2R,3S,4R)-2-ethyl-3,4-dihydro-2H-pyran-3,4-diol (PubChem CID 118517723) has the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. Its IUPAC name is (2R,3S,4R)-2-ethyl-3,4-dihydro-2H-pyran-3,4-diol.
| Compound Name | (2R,3S,4R)-2-ethyl-3,4-dihydro-2H-pyran-3,4-diol |
|---|---|
| PubChem CID | 118517723 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | (2R,3S,4R)-2-ethyl-3,4-dihydro-2H-pyran-3,4-diol |
| SMILES | CC[C@H]1OC=C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H12O3/c1-2-6-7(9)5(8)3-4-10-6/h3-9H,2H2,1H3/t5-,6-,7+/m1/s1 |
| InChIKey | HLLBWXVFCXJOPI-QYNIQEEDSA-N |
| XLogP | 0.03 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |