C8H14O3 — CID 143821584
(3S)-3-ethoxy-2-methyl-3,4-dihydro-2H-pyran-4-ol (PubChem CID 143821584) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is (3S)-3-ethoxy-2-methyl-3,4-dihydro-2H-pyran-4-ol.
| Compound Name | (3S)-3-ethoxy-2-methyl-3,4-dihydro-2H-pyran-4-ol |
|---|---|
| PubChem CID | 143821584 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (3S)-3-ethoxy-2-methyl-3,4-dihydro-2H-pyran-4-ol |
| SMILES | CCO[C@H]1C(O)C=COC1C |
| InChI | InChI=1S/C8H14O3/c1-3-10-8-6(2)11-5-4-7(8)9/h4-9H,3H2,1-2H3/t6?,7?,8-/m1/s1 |
| InChIKey | TXERNXHNGAVPBI-KAVNDROISA-N |
| XLogP | 0.68 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |