C10H19NO2 — CID 130145181
4-(diethylamino)-2-methyl-3,4-dihydro-2H-pyran-3-ol (PubChem CID 130145181) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 4-(diethylamino)-2-methyl-3,4-dihydro-2H-pyran-3-ol.
| Compound Name | 4-(diethylamino)-2-methyl-3,4-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 130145181 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 4-(diethylamino)-2-methyl-3,4-dihydro-2H-pyran-3-ol |
| SMILES | CCN(CC)C1C=COC(C)C1O |
| InChI | InChI=1S/C10H19NO2/c1-4-11(5-2)9-6-7-13-8(3)10(9)12/h6-10,12H,4-5H2,1-3H3 |
| InChIKey | AHOUWIPOXWEGHS-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |