C8H14O2 — CID 147708709
4-methoxy-2,3-dimethyl-3,4-dihydro-2H-pyran (PubChem CID 147708709) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is 4-methoxy-2,3-dimethyl-3,4-dihydro-2H-pyran.
| Compound Name | 4-methoxy-2,3-dimethyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 147708709 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 4-methoxy-2,3-dimethyl-3,4-dihydro-2H-pyran |
| SMILES | COC1C=COC(C)C1C |
| InChI | InChI=1S/C8H14O2/c1-6-7(2)10-5-4-8(6)9-3/h4-8H,1-3H3 |
| InChIKey | GUHCMKNDAYRXFU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |