C7H9NO3 — CID 102397144
(3aS,4S,7aS)-4-methyl-1,3a,4,7a-tetrahydropyrano[4,3-d][1,3]oxazol-2-one (PubChem CID 102397144) has the molecular formula C7H9NO3 and a molecular weight of 155.15 g/mol. Its IUPAC name is (3aS,4S,7aS)-4-methyl-1,3a,4,7a-tetrahydropyrano[4,3-d][1,3]oxazol-2-one.
| Compound Name | (3aS,4S,7aS)-4-methyl-1,3a,4,7a-tetrahydropyrano[4,3-d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 102397144 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | (3aS,4S,7aS)-4-methyl-1,3a,4,7a-tetrahydropyrano[4,3-d][1,3]oxazol-2-one |
| SMILES | C[C@@H]1OC=C[C@@H]2NC(=O)O[C@@H]21 |
| InChI | InChI=1S/C7H9NO3/c1-4-6-5(2-3-10-4)8-7(9)11-6/h2-6H,1H3,(H,8,9)/t4-,5-,6+/m0/s1 |
| InChIKey | PBCSCRYLYHHDPF-HCWXCVPCSA-N |
| XLogP | 0.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |