C10H17NO2 — CID 44558834
5-cyclohexyl-4-methyl-1,3-oxazolidin-2-one (PubChem CID 44558834) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 5-cyclohexyl-4-methyl-1,3-oxazolidin-2-one.
| Compound Name | 5-cyclohexyl-4-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 44558834 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 5-cyclohexyl-4-methyl-1,3-oxazolidin-2-one |
| SMILES | CC1NC(=O)OC1C1CCCCC1 |
| InChI | InChI=1S/C10H17NO2/c1-7-9(13-10(12)11-7)8-5-3-2-4-6-8/h7-9H,2-6H2,1H3,(H,11,12) |
| InChIKey | YGQBSMBHRDHGPJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |