C11H16INO2 — CID 15698611
(4S,5R)-5-cyclohexyl-4-(1-iodoethenyl)-1,3-oxazolidin-2-one (PubChem CID 15698611) has the molecular formula C11H16INO2 and a molecular weight of 321.16 g/mol. Its IUPAC name is (4S,5R)-5-cyclohexyl-4-(1-iodoethenyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-5-cyclohexyl-4-(1-iodoethenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 15698611 |
| Molecular Formula | C11H16INO2 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | (4S,5R)-5-cyclohexyl-4-(1-iodoethenyl)-1,3-oxazolidin-2-one |
| SMILES | C=C(I)[C@H]1NC(=O)O[C@@H]1C1CCCCC1 |
| InChI | InChI=1S/C11H16INO2/c1-7(12)9-10(15-11(14)13-9)8-5-3-2-4-6-8/h8-10H,1-6H2,(H,13,14)/t9-,10-/m1/s1 |
| InChIKey | OJMVWCXARCKURI-NXEZZACHSA-N |
| XLogP | 2.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|