C9H14O — CID 139265840
(3aR)-1,3,3a,4,5,6,7,7a-octahydroinden-2-one (PubChem CID 139265840) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is (3aR)-1,3,3a,4,5,6,7,7a-octahydroinden-2-one.
| Compound Name | (3aR)-1,3,3a,4,5,6,7,7a-octahydroinden-2-one |
|---|---|
| PubChem CID | 139265840 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | (3aR)-1,3,3a,4,5,6,7,7a-octahydroinden-2-one |
| SMILES | O=C1CC2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C9H14O/c10-9-5-7-3-1-2-4-8(7)6-9/h7-8H,1-6H2/t7-,8?/m1/s1 |
| InChIKey | HAMUKWWZXAKCAU-GVHYBUMESA-N |
| XLogP | 2.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |