C23H39OP — CID 101418777
(2S,6S)-1,2,6-tricyclohexylphosphinan-4-one (PubChem CID 101418777) has the molecular formula C23H39OP and a molecular weight of 362.54 g/mol. Its IUPAC name is (2S,6S)-1,2,6-tricyclohexylphosphinan-4-one.
| Compound Name | (2S,6S)-1,2,6-tricyclohexylphosphinan-4-one |
|---|---|
| PubChem CID | 101418777 |
| Molecular Formula | C23H39OP |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | (2S,6S)-1,2,6-tricyclohexylphosphinan-4-one |
| SMILES | O=C1C[C@@H](C2CCCCC2)P(C2CCCCC2)[C@H](C2CCCCC2)C1 |
| InChI | InChI=1S/C23H39OP/c24-20-16-22(18-10-4-1-5-11-18)25(21-14-8-3-9-15-21)23(17-20)19-12-6-2-7-13-19/h18-19,21-23H,1-17H2/t22-,23-/m0/s1 |
| InChIKey | AQZIENKWDLISCN-GOTSBHOMSA-N |
| XLogP | 7.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|