C22H39P — CID 101395115
(2R,5R)-1,2,5-tricyclohexylphospholane (PubChem CID 101395115) has the molecular formula C22H39P and a molecular weight of 334.53 g/mol. Its IUPAC name is (2R,5R)-1,2,5-tricyclohexylphospholane.
| Compound Name | (2R,5R)-1,2,5-tricyclohexylphospholane |
|---|---|
| PubChem CID | 101395115 |
| Molecular Formula | C22H39P |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.28 |
| IUPAC Name | (2R,5R)-1,2,5-tricyclohexylphospholane |
| SMILES | C1CCC([C@H]2CC[C@H](C3CCCCC3)P2C2CCCCC2)CC1 |
| InChI | InChI=1S/C22H39P/c1-4-10-18(11-5-1)21-16-17-22(19-12-6-2-7-13-19)23(21)20-14-8-3-9-15-20/h18-22H,1-17H2/t21-,22-/m1/s1 |
| InChIKey | KJHKEGZHYXGXPD-FGZHOGPDSA-N |
| XLogP | 7.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|