C32H56P2 — CID 11454879
(2S,4S)-2,4-dicyclohexyl-1-[2-[(2S,4S)-2,4-dicyclohexylphosphetan-1-yl]ethyl]phosphetane (PubChem CID 11454879) has the molecular formula C32H56P2 and a molecular weight of 502.75 g/mol. Its IUPAC name is (2S,4S)-2,4-dicyclohexyl-1-[2-[(2S,4S)-2,4-dicyclohexylphosphetan-1-yl]ethyl]phosphetane.
| Compound Name | (2S,4S)-2,4-dicyclohexyl-1-[2-[(2S,4S)-2,4-dicyclohexylphosphetan-1-yl]ethyl]phosphetane |
|---|---|
| PubChem CID | 11454879 |
| Molecular Formula | C32H56P2 |
| Molecular Weight | 502.75 g/mol |
| Exact Mass | 502.39 |
| IUPAC Name | (2S,4S)-2,4-dicyclohexyl-1-[2-[(2S,4S)-2,4-dicyclohexylphosphetan-1-yl]ethyl]phosphetane |
| SMILES | C1CCC([C@@H]2C[C@@H](C3CCCCC3)P2CCP2[C@H](C3CCCCC3)C[C@H]2C2CCCCC2)CC1 |
| InChI | InChI=1S/C32H56P2/c1-5-13-25(14-6-1)29-23-30(26-15-7-2-8-16-26)33(29)21-22-34-31(27-17-9-3-10-18-27)24-32(34)28-19-11-4-12-20-28/h25-32H,1-24H2/t29-,30-,31-,32-/m0/s1 |
| InChIKey | PIQCTVRKYSDHCR-YDPTYEFTSA-N |
| XLogP | 10.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.75 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|