About (3R)-2,2-dichloro-3-cyclohexylcyclobutan-1-one
(3R)-2,2-dichloro-3-cyclohexylcyclobutan-1-one (PubChem CID 129321055) has the molecular formula C10H14Cl2O
and a molecular weight of 221.13 g/mol. Its IUPAC name is (3R)-2,2-dichloro-3-cyclohexylcyclobutan-1-one.
Molecular Properties
| Compound Name | (3R)-2,2-dichloro-3-cyclohexylcyclobutan-1-one |
| PubChem CID | 129321055 |
| Molecular Formula | C10H14Cl2O |
| Molecular Weight | 221.13 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | (3R)-2,2-dichloro-3-cyclohexylcyclobutan-1-one |
| SMILES | O=C1C[C@H](C2CCCCC2)C1(Cl)Cl |
| InChI | InChI=1S/C10H14Cl2O/c11-10(12)8(6-9(10)13)7-4-2-1-3-5-7/h7-8H,1-6H2/t8-/m1/s1 |
| InChIKey | SGTKYKSNIWKMSF-MRVPVSSYSA-N |
| XLogP | 3.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.13 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (3R)-2,2-dichloro-3-cyclohexylcyclobutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-2,2-dichloro-3-cyclohexylcyclobutan-1-one?
The IUPAC name of (3R)-2,2-dichloro-3-cyclohexylcyclobutan-1-one (CID 129321055) is (3R)-2,2-dichloro-3-cyclohexylcyclobutan-1-one.
What is the SMILES notation for (3R)-2,2-dichloro-3-cyclohexylcyclobutan-1-one?
The canonical SMILES for (3R)-2,2-dichloro-3-cyclohexylcyclobutan-1-one is O=C1C[C@H](C2CCCCC2)C1(Cl)Cl.
What is the InChIKey of (3R)-2,2-dichloro-3-cyclohexylcyclobutan-1-one?
The InChIKey is SGTKYKSNIWKMSF-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H14Cl2O/c11-10(12)8(6-9(10)13)7-4-2-1-3-5-7/h7-8H,1-6H2/t8-/m1/s1.
What are the key properties of (3R)-2,2-dichloro-3-cyclohexylcyclobutan-1-one?
(3R)-2,2-dichloro-3-cyclohexylcyclobutan-1-one has a molecular weight of 221.13 g/mol, XLogP of 3.33, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-2,2-dichloro-3-cyclohexylcyclobutan-1-one is sourced from PubChem (CID 129321055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).