C12H20O — CID 156705467
(4aR)-8,8-dimethyl-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-one (PubChem CID 156705467) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (4aR)-8,8-dimethyl-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-one.
| Compound Name | (4aR)-8,8-dimethyl-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-one |
|---|---|
| PubChem CID | 156705467 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (4aR)-8,8-dimethyl-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-one |
| SMILES | CC1(C)CCC[C@@H]2CCC(=O)CC21 |
| InChI | InChI=1S/C12H20O/c1-12(2)7-3-4-9-5-6-10(13)8-11(9)12/h9,11H,3-8H2,1-2H3/t9-,11?/m1/s1 |
| InChIKey | DAHZSCKJSWKNPV-BFHBGLAWSA-N |
| XLogP | 3.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |