C15H24O — CID 134922448
(1R,2S,7R,10R)-3,3,7-trimethyltricyclo[5.5.0.02,10]dodecan-8-one (PubChem CID 134922448) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is (1R,2S,7R,10R)-3,3,7-trimethyltricyclo[5.5.0.02,10]dodecan-8-one.
| Compound Name | (1R,2S,7R,10R)-3,3,7-trimethyltricyclo[5.5.0.02,10]dodecan-8-one |
|---|---|
| PubChem CID | 134922448 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (1R,2S,7R,10R)-3,3,7-trimethyltricyclo[5.5.0.02,10]dodecan-8-one |
| SMILES | CC1(C)CCC[C@@]2(C)C(=O)C[C@H]3CC[C@@H]2[C@H]31 |
| InChI | InChI=1S/C15H24O/c1-14(2)7-4-8-15(3)11-6-5-10(13(11)14)9-12(15)16/h10-11,13H,4-9H2,1-3H3/t10-,11-,13+,15-/m1/s1 |
| InChIKey | IUSJLDGICLGLDM-UQFNBPPOSA-N |
| XLogP | 3.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |