C15H22I2 — CID 134901884
(1S,2S,7R,9R)-8-(diiodomethylidene)-3,3,7-trimethyltricyclo[5.4.0.02,9]undecane (PubChem CID 134901884) has the molecular formula C15H22I2 and a molecular weight of 456.15 g/mol. Its IUPAC name is (1S,2S,7R,9R)-8-(diiodomethylidene)-3,3,7-trimethyltricyclo[5.4.0.02,9]undecane.
| Compound Name | (1S,2S,7R,9R)-8-(diiodomethylidene)-3,3,7-trimethyltricyclo[5.4.0.02,9]undecane |
|---|---|
| PubChem CID | 134901884 |
| Molecular Formula | C15H22I2 |
| Molecular Weight | 456.15 g/mol |
| Exact Mass | 455.98 |
| IUPAC Name | (1S,2S,7R,9R)-8-(diiodomethylidene)-3,3,7-trimethyltricyclo[5.4.0.02,9]undecane |
| SMILES | CC1(C)CCC[C@@]2(C)C(=C(I)I)[C@@H]3CC[C@H]2[C@@H]31 |
| InChI | InChI=1S/C15H22I2/c1-14(2)7-4-8-15(3)10-6-5-9(11(10)14)12(15)13(16)17/h9-11H,4-8H2,1-3H3/t9-,10+,11-,15-/m1/s1 |
| InChIKey | DEGAYKHDIMTTAR-JNIYBQFBSA-N |
| XLogP | 5.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.15 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|