C29H35NO2 — CID 15967158
(E)-N-[(4-phenoxyphenyl)methoxy]-2-[(1R,2R,7S,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanylidene]ethanimine (PubChem CID 15967158) has the molecular formula C29H35NO2 and a molecular weight of 429.60 g/mol. Its IUPAC name is (E)-N-[(4-phenoxyphenyl)methoxy]-2-[(1R,2R,7S,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanylidene]ethanimine.
| Compound Name | (E)-N-[(4-phenoxyphenyl)methoxy]-2-[(1R,2R,7S,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanylidene]ethanimine |
|---|---|
| PubChem CID | 15967158 |
| Molecular Formula | C29H35NO2 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | (E)-N-[(4-phenoxyphenyl)methoxy]-2-[(1R,2R,7S,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanylidene]ethanimine |
| SMILES | CC1(C)CCC[C@]2(C)C(=C/C=N/OCc3ccc(Oc4ccccc4)cc3)[C@H]3CC[C@@H]2[C@H]31 |
| InChI | InChI=1S/C29H35NO2/c1-28(2)17-7-18-29(3)25(24-14-15-26(29)27(24)28)16-19-30-31-20-21-10-12-23(13-11-21)32-22-8-5-4-6-9-22/h4-6,8-13,16,19,24,26-27H,7,14-15,17-18,20H2,1-3H3/b25-16?,30-19+/t24-,26-,27+,29-/m1/s1 |
| InChIKey | NEAQUKGAVXLOEW-JAXYVAMUSA-N |
| XLogP | 7.78 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|