C15H19NO2 — CID 15882424
(2E)-1-cyclohexyl-2-phenylmethoxyiminoethanone (PubChem CID 15882424) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is (2E)-1-cyclohexyl-2-phenylmethoxyiminoethanone.
| Compound Name | (2E)-1-cyclohexyl-2-phenylmethoxyiminoethanone |
|---|---|
| PubChem CID | 15882424 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (2E)-1-cyclohexyl-2-phenylmethoxyiminoethanone |
| SMILES | O=C(/C=N/OCc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C15H19NO2/c17-15(14-9-5-2-6-10-14)11-16-18-12-13-7-3-1-4-8-13/h1,3-4,7-8,11,14H,2,5-6,9-10,12H2/b16-11+ |
| InChIKey | SCZRZVHORMKMQF-LFIBNONCSA-N |
| XLogP | 3.34 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|