C19H20N2O2 — CID 11415596
phenyl-[2-[(E)-phenylmethoxyiminomethyl]pyrrolidin-1-yl]methanone (PubChem CID 11415596) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is phenyl-[2-[(E)-phenylmethoxyiminomethyl]pyrrolidin-1-yl]methanone.
| Compound Name | phenyl-[2-[(E)-phenylmethoxyiminomethyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 11415596 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | phenyl-[2-[(E)-phenylmethoxyiminomethyl]pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccccc1)N1CCCC1/C=N/OCc1ccccc1 |
| InChI | InChI=1S/C19H20N2O2/c22-19(17-10-5-2-6-11-17)21-13-7-12-18(21)14-20-23-15-16-8-3-1-4-9-16/h1-6,8-11,14,18H,7,12-13,15H2/b20-14+ |
| InChIKey | CBQSQHQDOXXULC-XSFVSMFZSA-N |
| XLogP | 3.49 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|