C19H20N2O3 — CID 87539219
2-(C-phenyl-N-phenylmethoxycarbonimidoyl)pyrrolidine-1-carboxylic acid (PubChem CID 87539219) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-(C-phenyl-N-phenylmethoxycarbonimidoyl)pyrrolidine-1-carboxylic acid.
| Compound Name | 2-(C-phenyl-N-phenylmethoxycarbonimidoyl)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87539219 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 2-(C-phenyl-N-phenylmethoxycarbonimidoyl)pyrrolidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCCC1C(=NOCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O3/c22-19(23)21-13-7-12-17(21)18(16-10-5-2-6-11-16)20-24-14-15-8-3-1-4-9-15/h1-6,8-11,17H,7,12-14H2,(H,22,23) |
| InChIKey | UMLPMJZXHXHDTE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|