C15H16N3O5+ — CID 87973610
[1-(1-carboxypyrrolidin-2-yl)-1,3-dioxo-3-phenylmethoxypropan-2-ylidene]-iminoazanium (PubChem CID 87973610) has the molecular formula C15H16N3O5+ and a molecular weight of 318.31 g/mol. Its IUPAC name is [1-(1-carboxypyrrolidin-2-yl)-1,3-dioxo-3-phenylmethoxypropan-2-ylidene]-iminoazanium.
| Compound Name | [1-(1-carboxypyrrolidin-2-yl)-1,3-dioxo-3-phenylmethoxypropan-2-ylidene]-iminoazanium |
|---|---|
| PubChem CID | 87973610 |
| Molecular Formula | C15H16N3O5+ |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | [1-(1-carboxypyrrolidin-2-yl)-1,3-dioxo-3-phenylmethoxypropan-2-ylidene]-iminoazanium |
| SMILES | N=[N+]=C(C(=O)OCc1ccccc1)C(=O)C1CCCN1C(=O)O |
| InChI | InChI=1S/C15H15N3O5/c16-17-12(13(19)11-7-4-8-18(11)15(21)22)14(20)23-9-10-5-2-1-3-6-10/h1-3,5-6,11,16H,4,7-9H2/p+1 |
| InChIKey | SGGYXJUNUJTXSV-UHFFFAOYSA-O |
| XLogP | 1.12 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|