About 2-[[[(2Z)-2-cyclohexyl-2-methoxyiminoethylidene]amino]oxymethyl]benzoic acid;ethane
2-[[[(2Z)-2-cyclohexyl-2-methoxyiminoethylidene]amino]oxymethyl]benzoic acid;ethane (PubChem CID 90984211) has the molecular formula C19H28N2O4
and a molecular weight of 348.44 g/mol. Its IUPAC name is 2-[[[(2Z)-2-cyclohexyl-2-methoxyiminoethylidene]amino]oxymethyl]benzoic acid;ethane.
Molecular Properties
| Compound Name | 2-[[[(2Z)-2-cyclohexyl-2-methoxyiminoethylidene]amino]oxymethyl]benzoic acid;ethane |
| PubChem CID | 90984211 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2-[[[(2Z)-2-cyclohexyl-2-methoxyiminoethylidene]amino]oxymethyl]benzoic acid;ethane |
| SMILES | CC.CO/N=C(\C=NOCc1ccccc1C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C17H22N2O4.C2H6/c1-22-19-16(13-7-3-2-4-8-13)11-18-23-12-14-9-5-6-10-15(14)17(20)21;1-2/h5-6,9-11,13H,2-4,7-8,12H2,1H3,(H,20,21);1-2H3/b18-11?,19-16+; |
| InChIKey | HTBSFLLIJBEGJW-MRJSYYJXSA-N |
| XLogP | 4.50 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[[(2Z)-2-cyclohexyl-2-methoxyiminoethylidene]amino]oxymethyl]benzoic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[[(2Z)-2-cyclohexyl-2-methoxyiminoethylidene]amino]oxymethyl]benzoic acid;ethane?
The IUPAC name of 2-[[[(2Z)-2-cyclohexyl-2-methoxyiminoethylidene]amino]oxymethyl]benzoic acid;ethane (CID 90984211) is 2-[[[(2Z)-2-cyclohexyl-2-methoxyiminoethylidene]amino]oxymethyl]benzoic acid;ethane.
What is the SMILES notation for 2-[[[(2Z)-2-cyclohexyl-2-methoxyiminoethylidene]amino]oxymethyl]benzoic acid;ethane?
The canonical SMILES for 2-[[[(2Z)-2-cyclohexyl-2-methoxyiminoethylidene]amino]oxymethyl]benzoic acid;ethane is CC.CO/N=C(\C=NOCc1ccccc1C(=O)O)C1CCCCC1.
What is the InChIKey of 2-[[[(2Z)-2-cyclohexyl-2-methoxyiminoethylidene]amino]oxymethyl]benzoic acid;ethane?
The InChIKey is HTBSFLLIJBEGJW-MRJSYYJXSA-N. The full InChI is InChI=1S/C17H22N2O4.C2H6/c1-22-19-16(13-7-3-2-4-8-13)11-18-23-12-14-9-5-6-10-15(14)17(20)21;1-2/h5-6,9-11,13H,2-4,7-8,12H2,1H3,(H,20,21);1-2H3/b18-11?,19-16+;.
What are the key properties of 2-[[[(2Z)-2-cyclohexyl-2-methoxyiminoethylidene]amino]oxymethyl]benzoic acid;ethane?
2-[[[(2Z)-2-cyclohexyl-2-methoxyiminoethylidene]amino]oxymethyl]benzoic acid;ethane has a molecular weight of 348.44 g/mol, XLogP of 4.50, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[[(2Z)-2-cyclohexyl-2-methoxyiminoethylidene]amino]oxymethyl]benzoic acid;ethane is sourced from PubChem (CID 90984211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).