C17H17N5O4S — CID 173278414
2-methoxyimino-2-[2-[[2-(5-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl)ethylideneamino]oxymethyl]phenyl]acetic acid (PubChem CID 173278414) has the molecular formula C17H17N5O4S and a molecular weight of 387.42 g/mol. Its IUPAC name is 2-methoxyimino-2-[2-[[2-(5-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl)ethylideneamino]oxymethyl]phenyl]acetic acid.
| Compound Name | 2-methoxyimino-2-[2-[[2-(5-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl)ethylideneamino]oxymethyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 173278414 |
| Molecular Formula | C17H17N5O4S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 2-methoxyimino-2-[2-[[2-(5-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl)ethylideneamino]oxymethyl]phenyl]acetic acid |
| SMILES | CON=C(C(=O)O)c1ccccc1CON=CCc1c(C)sc2ncnn12 |
| InChI | InChI=1S/C17H17N5O4S/c1-11-14(22-17(27-11)18-10-19-22)7-8-20-26-9-12-5-3-4-6-13(12)15(16(23)24)21-25-2/h3-6,8,10H,7,9H2,1-2H3,(H,23,24) |
| InChIKey | DWJBAHNGFGTMPN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|