C21H21Br2N3O3 — CID 140557349
(2Z)-2-[2-[[(E)-2-[3-(2,2-dibromoethenyl)phenyl]ethylideneamino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide (PubChem CID 140557349) has the molecular formula C21H21Br2N3O3 and a molecular weight of 523.23 g/mol. Its IUPAC name is (2Z)-2-[2-[[(E)-2-[3-(2,2-dibromoethenyl)phenyl]ethylideneamino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide.
| Compound Name | (2Z)-2-[2-[[(E)-2-[3-(2,2-dibromoethenyl)phenyl]ethylideneamino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide |
|---|---|
| PubChem CID | 140557349 |
| Molecular Formula | C21H21Br2N3O3 |
| Molecular Weight | 523.23 g/mol |
| Exact Mass | 520.99 |
| IUPAC Name | (2Z)-2-[2-[[(E)-2-[3-(2,2-dibromoethenyl)phenyl]ethylideneamino]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide |
| SMILES | CNC(=O)/C(=N\OC)c1ccccc1CO/N=C/Cc1cccc(C=C(Br)Br)c1 |
| InChI | InChI=1S/C21H21Br2N3O3/c1-24-21(27)20(26-28-2)18-9-4-3-8-17(18)14-29-25-11-10-15-6-5-7-16(12-15)13-19(22)23/h3-9,11-13H,10,14H2,1-2H3,(H,24,27)/b25-11+,26-20- |
| InChIKey | SMSYIMUHVWPFOJ-NDKRMRFOSA-N |
| XLogP | 4.62 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.23 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|